About 3-(hydroxyamino)phenol
3-(hydroxyamino)phenol (PubChem CID 5460445) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is 3-(hydroxyamino)phenol.
Molecular Properties
| Compound Name | 3-(hydroxyamino)phenol |
| PubChem CID | 5460445 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 3-(hydroxyamino)phenol |
| SMILES | ONc1cccc(O)c1 |
| InChI | InChI=1S/C6H7NO2/c8-6-3-1-2-5(4-6)7-9/h1-4,7-9H |
| InChIKey | NAKOPKHXTPVJIZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(hydroxyamino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxyamino)phenol?
The IUPAC name of 3-(hydroxyamino)phenol (CID 5460445) is 3-(hydroxyamino)phenol.
What is the SMILES notation for 3-(hydroxyamino)phenol?
The canonical SMILES for 3-(hydroxyamino)phenol is ONc1cccc(O)c1.
What is the InChIKey of 3-(hydroxyamino)phenol?
The InChIKey is NAKOPKHXTPVJIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2/c8-6-3-1-2-5(4-6)7-9/h1-4,7-9H.
What are the key properties of 3-(hydroxyamino)phenol?
3-(hydroxyamino)phenol has a molecular weight of 125.13 g/mol, XLogP of 1.19, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxyamino)phenol is sourced from PubChem (CID 5460445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).