cobalt;phosphonosulfanylphosphonic acid

H4CoO6P2S — CID 54604626

IUPACcobalt;phosphonosulfanylphosphonic acid
SMILESO=P(O)(O)SP(=O)(O)O.[Co]
InChIInChI=1S/Co.H4O6P2S/c;1-7(2,3)9-8(4,5)6/h;(H2,1,2,3)(H2,4,5,6)
InChIKeyMTYKWGYQCJBVFN-UHFFFAOYSA-N
MW252.97 g/mol
LogP-0.10
Rot. Bonds2

About cobalt;phosphonosulfanylphosphonic acid

cobalt;phosphonosulfanylphosphonic acid (PubChem CID 54604626) has the molecular formula H4CoO6P2S and a molecular weight of 252.97 g/mol. Its IUPAC name is cobalt;phosphonosulfanylphosphonic acid.

Molecular Properties

Compound Namecobalt;phosphonosulfanylphosphonic acid
PubChem CID54604626
Molecular FormulaH4CoO6P2S
Molecular Weight252.97 g/mol
Exact Mass252.85
IUPAC Namecobalt;phosphonosulfanylphosphonic acid
SMILESO=P(O)(O)SP(=O)(O)O.[Co]
InChIInChI=1S/Co.H4O6P2S/c;1-7(2,3)9-8(4,5)6/h;(H2,1,2,3)(H2,4,5,6)
InChIKeyMTYKWGYQCJBVFN-UHFFFAOYSA-N
XLogP-0.10
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.97
LogP ≤ 5-0.10
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze cobalt;phosphonosulfanylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cobalt;phosphonosulfanylphosphonic acid?
The IUPAC name of cobalt;phosphonosulfanylphosphonic acid (CID 54604626) is cobalt;phosphonosulfanylphosphonic acid.
What is the SMILES notation for cobalt;phosphonosulfanylphosphonic acid?
The canonical SMILES for cobalt;phosphonosulfanylphosphonic acid is O=P(O)(O)SP(=O)(O)O.[Co].
What is the InChIKey of cobalt;phosphonosulfanylphosphonic acid?
The InChIKey is MTYKWGYQCJBVFN-UHFFFAOYSA-N. The full InChI is InChI=1S/Co.H4O6P2S/c;1-7(2,3)9-8(4,5)6/h;(H2,1,2,3)(H2,4,5,6).
What are the key properties of cobalt;phosphonosulfanylphosphonic acid?
cobalt;phosphonosulfanylphosphonic acid has a molecular weight of 252.97 g/mol, XLogP of -0.10, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;phosphonosulfanylphosphonic acid is sourced from PubChem (CID 54604626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).