About dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide)
dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) (PubChem CID 54604644) has the molecular formula C20H36Cl2CoN4-4
and a molecular weight of 462.38 g/mol. Its IUPAC name is dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide).
Molecular Properties
| Compound Name | dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) |
| PubChem CID | 54604644 |
| Molecular Formula | C20H36Cl2CoN4-4 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) |
| SMILES | C1CCC(C2CCCC[N-]2)[N-]C1.C1CCC(C2CCCC[N-]2)[N-]C1.Cl[Co]Cl |
| InChI | InChI=1S/2C10H18N2.2ClH.Co/c2*1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;/h2*9-10H,1-8H2;2*1H;/q2*-2;;;+2/p-2 |
| InChIKey | BJVOWYKHXLKYOO-UHFFFAOYSA-L |
| XLogP | 7.05 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide)?
The IUPAC name of dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) (CID 54604644) is dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide).
What is the SMILES notation for dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide)?
The canonical SMILES for dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) is C1CCC(C2CCCC[N-]2)[N-]C1.C1CCC(C2CCCC[N-]2)[N-]C1.Cl[Co]Cl.
What is the InChIKey of dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide)?
The InChIKey is BJVOWYKHXLKYOO-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H18N2.2ClH.Co/c2*1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;/h2*9-10H,1-8H2;2*1H;/q2*-2;;;+2/p-2.
What are the key properties of dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide)?
dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) has a molecular weight of 462.38 g/mol, XLogP of 7.05, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocobalt;bis(2-piperidin-1-id-2-ylpiperidin-1-ide) is sourced from PubChem (CID 54604644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).