C12H15ClN4O — CID 54604691
[3-[(2-amino-6-methylpyrimidin-4-yl)amino]phenyl]methanol;hydrochloride (PubChem CID 54604691) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is [3-[(2-amino-6-methylpyrimidin-4-yl)amino]phenyl]methanol;hydrochloride.
| Compound Name | [3-[(2-amino-6-methylpyrimidin-4-yl)amino]phenyl]methanol;hydrochloride |
|---|---|
| PubChem CID | 54604691 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | [3-[(2-amino-6-methylpyrimidin-4-yl)amino]phenyl]methanol;hydrochloride |
| SMILES | Cc1cc(Nc2cccc(CO)c2)nc(N)n1.Cl |
| InChI | InChI=1S/C12H14N4O.ClH/c1-8-5-11(16-12(13)14-8)15-10-4-2-3-9(6-10)7-17;/h2-6,17H,7H2,1H3,(H3,13,14,15,16);1H |
| InChIKey | QGWZYRFJMFKKKP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |