C26H35ClN4O8S2 — CID 54604718
[5-[(2-amino-4-methylsulfanylbutanoyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-amino-4-methylsulfanylbutanoate;hydrochloride (PubChem CID 54604718) has the molecular formula C26H35ClN4O8S2 and a molecular weight of 631.17 g/mol. Its IUPAC name is [5-[(2-amino-4-methylsulfanylbutanoyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-amino-4-methylsulfanylbutanoate;hydrochloride.
| Compound Name | [5-[(2-amino-4-methylsulfanylbutanoyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-amino-4-methylsulfanylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 54604718 |
| Molecular Formula | C26H35ClN4O8S2 |
| Molecular Weight | 631.17 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | [5-[(2-amino-4-methylsulfanylbutanoyl)oxymethyl]-4,6,11,13-tetraoxo-5,12-diazapentacyclo[7.5.2.02,8.03,7.010,14]hexadec-15-en-12-yl]methyl 2-amino-4-methylsulfanylbutanoate;hydrochloride |
| SMILES | CSCCC(N)C(=O)OCN1C(=O)C2C3C=CC(C2C1=O)C1C2C(=O)N(COC(=O)C(N)CCSC)C(=O)C2C31.Cl |
| InChI | InChI=1S/C26H34N4O8S2.ClH/c1-39-7-5-13(27)25(35)37-9-29-21(31)17-11-3-4-12(18(17)22(29)32)16-15(11)19-20(16)24(34)30(23(19)33)10-38-26(36)14(28)6-8-40-2;/h3-4,11-20H,5-10,27-28H2,1-2H3;1H |
| InChIKey | QDHSCSKRSZYKCW-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 179.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.17 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|