C14H10Cl4NaO4+ — CID 54604948
sodium 2,3,4,5-tetrachloro-6-(3-methylpent-1-yn-3-yloxycarbonyl)benzoic acid (PubChem CID 54604948) has the molecular formula C14H10Cl4NaO4+ and a molecular weight of 407.03 g/mol. Its IUPAC name is sodium 2,3,4,5-tetrachloro-6-(3-methylpent-1-yn-3-yloxycarbonyl)benzoic acid.
| Compound Name | sodium 2,3,4,5-tetrachloro-6-(3-methylpent-1-yn-3-yloxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 54604948 |
| Molecular Formula | C14H10Cl4NaO4+ |
| Molecular Weight | 407.03 g/mol |
| Exact Mass | 404.92 |
| IUPAC Name | sodium 2,3,4,5-tetrachloro-6-(3-methylpent-1-yn-3-yloxycarbonyl)benzoic acid |
| SMILES | C#CC(C)(CC)OC(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O.[Na+] |
| InChI | InChI=1S/C14H10Cl4O4.Na/c1-4-14(3,5-2)22-13(21)7-6(12(19)20)8(15)10(17)11(18)9(7)16;/h1H,5H2,2-3H3,(H,19,20);/q;+1 |
| InChIKey | OMTGJMKEAXOGIE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.03 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|