About 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium
3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium (PubChem CID 54604994) has the molecular formula C12H20N2+2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium.
Molecular Properties
| Compound Name | 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium |
| PubChem CID | 54604994 |
| Molecular Formula | C12H20N2+2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium |
| SMILES | C[n+]1cccc([C@H]2CCC[N+]2(C)C)c1 |
| InChI | InChI=1S/C12H20N2/c1-13-8-4-6-11(10-13)12-7-5-9-14(12,2)3/h4,6,8,10,12H,5,7,9H2,1-3H3/q+2/t12-/m1/s1 |
| InChIKey | JOEQGJUIJYDQRN-GFCCVEGCSA-N |
| XLogP | 1.42 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium?
The IUPAC name of 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium (CID 54604994) is 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium.
What is the SMILES notation for 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium?
The canonical SMILES for 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium is C[n+]1cccc([C@H]2CCC[N+]2(C)C)c1.
What is the InChIKey of 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium?
The InChIKey is JOEQGJUIJYDQRN-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H20N2/c1-13-8-4-6-11(10-13)12-7-5-9-14(12,2)3/h4,6,8,10,12H,5,7,9H2,1-3H3/q+2/t12-/m1/s1.
What are the key properties of 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium?
3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium has a molecular weight of 192.31 g/mol, XLogP of 1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R)-1,1-dimethylpyrrolidin-1-ium-2-yl]-1-methylpyridin-1-ium is sourced from PubChem (CID 54604994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).