C23H36N4O4 — CID 54605046
1-N,1-N-diethyl-4-N-[3-(quinolin-8-ylamino)propyl]pentane-1,4-diamine;oxalic acid (PubChem CID 54605046) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-[3-(quinolin-8-ylamino)propyl]pentane-1,4-diamine;oxalic acid.
| Compound Name | 1-N,1-N-diethyl-4-N-[3-(quinolin-8-ylamino)propyl]pentane-1,4-diamine;oxalic acid |
|---|---|
| PubChem CID | 54605046 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-[3-(quinolin-8-ylamino)propyl]pentane-1,4-diamine;oxalic acid |
| SMILES | CCN(CC)CCCC(C)NCCCNc1cccc2cccnc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H34N4.C2H2O4/c1-4-25(5-2)17-8-10-18(3)22-15-9-16-23-20-13-6-11-19-12-7-14-24-21(19)20;3-1(4)2(5)6/h6-7,11-14,18,22-23H,4-5,8-10,15-17H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | XQEOQQCOWTWKNU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|