C33H24N6NaO9S2+ — CID 54605154
sodium (3E)-4-oxo-7-[[(6Z)-5-oxo-6-(phenylhydrazinylidene)-7-sulfonaphthalen-2-yl]carbamoylamino]-3-(phenylhydrazinylidene)naphthalene-2-sulfonic acid (PubChem CID 54605154) has the molecular formula C33H24N6NaO9S2+ and a molecular weight of 735.71 g/mol. Its IUPAC name is sodium (3E)-4-oxo-7-[[(6Z)-5-oxo-6-(phenylhydrazinylidene)-7-sulfonaphthalen-2-yl]carbamoylamino]-3-(phenylhydrazinylidene)naphthalene-2-sulfonic acid.
| Compound Name | sodium (3E)-4-oxo-7-[[(6Z)-5-oxo-6-(phenylhydrazinylidene)-7-sulfonaphthalen-2-yl]carbamoylamino]-3-(phenylhydrazinylidene)naphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 54605154 |
| Molecular Formula | C33H24N6NaO9S2+ |
| Molecular Weight | 735.71 g/mol |
| Exact Mass | 735.09 |
| IUPAC Name | sodium (3E)-4-oxo-7-[[(6Z)-5-oxo-6-(phenylhydrazinylidene)-7-sulfonaphthalen-2-yl]carbamoylamino]-3-(phenylhydrazinylidene)naphthalene-2-sulfonic acid |
| SMILES | O=C(Nc1ccc2c(c1)C=C(S(=O)(=O)O)/C(=N\Nc1ccccc1)C2=O)Nc1ccc2c(c1)C=C(S(=O)(=O)O)/C(=N/Nc1ccccc1)C2=O.[Na+] |
| InChI | InChI=1S/C33H24N6O9S2.Na/c40-31-25-13-11-23(15-19(25)17-27(49(43,44)45)29(31)38-36-21-7-3-1-4-8-21)34-33(42)35-24-12-14-26-20(16-24)18-28(50(46,47)48)30(32(26)41)39-37-22-9-5-2-6-10-22;/h1-18,36-37H,(H2,34,35,42)(H,43,44,45)(H,46,47,48);/q;+1/b38-29-,39-30+; |
| InChIKey | RTZVLWWYJLVVLL-ATQMXKFDSA-N |
| XLogP | 2.12 |
| TPSA | 232.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.71 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|