About Bis(2-methylprop-2-en-1-yl)carbamodithioic acid--lead (1/1)
Bis(2-methylprop-2-en-1-yl)carbamodithioic acid--lead (1/1) (PubChem CID 54605419) has the molecular formula C9H15NPbS2
and a molecular weight of 408.56 g/mol.
Molecular Properties
| Compound Name | Bis(2-methylprop-2-en-1-yl)carbamodithioic acid--lead (1/1) |
| PubChem CID | 54605419 |
| Molecular Formula | C9H15NPbS2 |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | — |
| SMILES | C=C(C)CN(CC(=C)C)C(=S)S.[Pb] |
| InChI | InChI=1S/C9H15NS2.Pb/c1-7(2)5-10(9(11)12)6-8(3)4;/h1,3,5-6H2,2,4H3,(H,11,12); |
| InChIKey | JVBQZACUEMEDHE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze Bis(2-methylprop-2-en-1-yl)carbamodithioic acid--lead (1/1) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Bis(2-methylprop-2-en-1-yl)carbamodithioic acid--lead (1/1)?
The IUPAC name of Bis(2-methylprop-2-en-1-yl)carbamodithioic acid--lead (1/1) (CID 54605419) is not available.
What is the SMILES notation for Bis(2-methylprop-2-en-1-yl)carbamodithioic acid--lead (1/1)?
The canonical SMILES for Bis(2-methylprop-2-en-1-yl)carbamodithioic acid--lead (1/1) is C=C(C)CN(CC(=C)C)C(=S)S.[Pb].
What is the InChIKey of Bis(2-methylprop-2-en-1-yl)carbamodithioic acid--lead (1/1)?
The InChIKey is JVBQZACUEMEDHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NS2.Pb/c1-7(2)5-10(9(11)12)6-8(3)4;/h1,3,5-6H2,2,4H3,(H,11,12);.
What are the key properties of Bis(2-methylprop-2-en-1-yl)carbamodithioic acid--lead (1/1)?
Bis(2-methylprop-2-en-1-yl)carbamodithioic acid--lead (1/1) has a molecular weight of 408.56 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Bis(2-methylprop-2-en-1-yl)carbamodithioic acid--lead (1/1) is sourced from PubChem (CID 54605419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).