About 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride
2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride (PubChem CID 54605666) has the molecular formula C11H23ClN4
and a molecular weight of 246.79 g/mol. Its IUPAC name is 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride |
| PubChem CID | 54605666 |
| Molecular Formula | C11H23ClN4 |
| Molecular Weight | 246.79 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride |
| SMILES | CC(C)=CCCC(C)C/C=N\N=C(N)N.Cl |
| InChI | InChI=1S/C11H22N4.ClH/c1-9(2)5-4-6-10(3)7-8-14-15-11(12)13;/h5,8,10H,4,6-7H2,1-3H3,(H4,12,13,15);1H/b14-8-; |
| InChIKey | SAKHRWJBQLLUAO-ZXDBEMHSSA-N |
| XLogP | 2.44 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.79 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride?
The IUPAC name of 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride (CID 54605666) is 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride.
What is the SMILES notation for 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride?
The canonical SMILES for 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride is CC(C)=CCCC(C)C/C=N\N=C(N)N.Cl.
What is the InChIKey of 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride?
The InChIKey is SAKHRWJBQLLUAO-ZXDBEMHSSA-N. The full InChI is InChI=1S/C11H22N4.ClH/c1-9(2)5-4-6-10(3)7-8-14-15-11(12)13;/h5,8,10H,4,6-7H2,1-3H3,(H4,12,13,15);1H/b14-8-;.
What are the key properties of 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride?
2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride has a molecular weight of 246.79 g/mol, XLogP of 2.44, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-3,7-dimethyloct-6-enylideneamino]guanidine;hydrochloride is sourced from PubChem (CID 54605666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).