C10H8O6-2 — CID 5460580
(5S,6S)-5-(1-carboxylatoethenoxy)-6-hydroxycyclohexa-1,3-diene-1-carboxylate (PubChem CID 5460580) has the molecular formula C10H8O6-2 and a molecular weight of 224.17 g/mol. Its IUPAC name is (5S,6S)-5-(1-carboxylatoethenoxy)-6-hydroxycyclohexa-1,3-diene-1-carboxylate.
| Compound Name | (5S,6S)-5-(1-carboxylatoethenoxy)-6-hydroxycyclohexa-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 5460580 |
| Molecular Formula | C10H8O6-2 |
| Molecular Weight | 224.17 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | (5S,6S)-5-(1-carboxylatoethenoxy)-6-hydroxycyclohexa-1,3-diene-1-carboxylate |
| SMILES | C=C(O[C@H]1C=CC=C(C(=O)[O-])[C@@H]1O)C(=O)[O-] |
| InChI | InChI=1S/C10H10O6/c1-5(9(12)13)16-7-4-2-3-6(8(7)11)10(14)15/h2-4,7-8,11H,1H2,(H,12,13)(H,14,15)/p-2/t7-,8-/m0/s1 |
| InChIKey | NTGWPRCCOQCMGE-YUMQZZPRSA-L |
| XLogP | -2.76 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.17 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|