About S-methyl pentanethioate
S-methyl pentanethioate (PubChem CID 546060) has the molecular formula C6H12OS
and a molecular weight of 132.23 g/mol. Its IUPAC name is S-methyl pentanethioate.
Molecular Properties
| Compound Name | S-methyl pentanethioate |
| PubChem CID | 546060 |
| Molecular Formula | C6H12OS |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | S-methyl pentanethioate |
| SMILES | CCCCC(=O)SC |
| InChI | InChI=1S/C6H12OS/c1-3-4-5-6(7)8-2/h3-5H2,1-2H3 |
| InChIKey | MWHCJABIXNVCHK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl pentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl pentanethioate?
The IUPAC name of S-methyl pentanethioate (CID 546060) is S-methyl pentanethioate.
What is the SMILES notation for S-methyl pentanethioate?
The canonical SMILES for S-methyl pentanethioate is CCCCC(=O)SC.
What is the InChIKey of S-methyl pentanethioate?
The InChIKey is MWHCJABIXNVCHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12OS/c1-3-4-5-6(7)8-2/h3-5H2,1-2H3.
What are the key properties of S-methyl pentanethioate?
S-methyl pentanethioate has a molecular weight of 132.23 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl pentanethioate is sourced from PubChem (CID 546060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).