C16H26N2O2 — CID 54606271
7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-1-ol (PubChem CID 54606271) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-1-ol.
| Compound Name | 7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-1-ol |
|---|---|
| PubChem CID | 54606271 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 7-methylidene-1,2,3,5,6,8-hexahydropyrrolizin-1-ol |
| SMILES | C=C1CCN2CCC(O)C12.C=C1CCN2CCC(O)C12 |
| InChI | InChI=1S/2C8H13NO/c2*1-6-2-4-9-5-3-7(10)8(6)9/h2*7-8,10H,1-5H2 |
| InChIKey | IEKXCSHZRWNPLP-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|