C18H10Cl4N4O2 — CID 54606337
(E)-1-(furan-2-yl)-N-[(Z)-[2,3,5,6-tetrachloro-4-[(E)-[(Z)-furan-2-ylmethylidenehydrazinylidene]methyl]phenyl]methylideneamino]methanimine (PubChem CID 54606337) has the molecular formula C18H10Cl4N4O2 and a molecular weight of 456.12 g/mol. Its IUPAC name is (E)-1-(furan-2-yl)-N-[(Z)-[2,3,5,6-tetrachloro-4-[(E)-[(Z)-furan-2-ylmethylidenehydrazinylidene]methyl]phenyl]methylideneamino]methanimine.
| Compound Name | (E)-1-(furan-2-yl)-N-[(Z)-[2,3,5,6-tetrachloro-4-[(E)-[(Z)-furan-2-ylmethylidenehydrazinylidene]methyl]phenyl]methylideneamino]methanimine |
|---|---|
| PubChem CID | 54606337 |
| Molecular Formula | C18H10Cl4N4O2 |
| Molecular Weight | 456.12 g/mol |
| Exact Mass | 453.96 |
| IUPAC Name | (E)-1-(furan-2-yl)-N-[(Z)-[2,3,5,6-tetrachloro-4-[(E)-[(Z)-furan-2-ylmethylidenehydrazinylidene]methyl]phenyl]methylideneamino]methanimine |
| SMILES | Clc1c(Cl)c(/C=N/N=C\c2ccco2)c(Cl)c(Cl)c1/C=N\N=C\c1ccco1 |
| InChI | InChI=1S/C18H10Cl4N4O2/c19-15-13(9-25-23-7-11-3-1-5-27-11)16(20)18(22)14(17(15)21)10-26-24-8-12-4-2-6-28-12/h1-10H/b23-7-,24-8+,25-9+,26-10- |
| InChIKey | WKTXZKFKUSWSFE-GBOZYVHPSA-N |
| XLogP | 6.39 |
| TPSA | 75.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.12 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|