About (Z)-but-2-enedioic acid;ethene;manganese
(Z)-but-2-enedioic acid;ethene;manganese (PubChem CID 54606396) has the molecular formula C6H8MnO4
and a molecular weight of 199.06 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;ethene;manganese.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;ethene;manganese |
| PubChem CID | 54606396 |
| Molecular Formula | C6H8MnO4 |
| Molecular Weight | 199.06 g/mol |
| Exact Mass | 198.98 |
| IUPAC Name | (Z)-but-2-enedioic acid;ethene;manganese |
| SMILES | C=C.O=C(O)/C=C\C(=O)O.[Mn] |
| InChI | InChI=1S/C4H4O4.C2H4.Mn/c5-3(6)1-2-4(7)8;1-2;/h1-2H,(H,5,6)(H,7,8);1-2H2;/b2-1-;; |
| InChIKey | NAMTTZIYKDNVFJ-UAIGNFCESA-N |
| XLogP | 0.51 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.06 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;ethene;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;ethene;manganese?
The IUPAC name of (Z)-but-2-enedioic acid;ethene;manganese (CID 54606396) is (Z)-but-2-enedioic acid;ethene;manganese.
What is the SMILES notation for (Z)-but-2-enedioic acid;ethene;manganese?
The canonical SMILES for (Z)-but-2-enedioic acid;ethene;manganese is C=C.O=C(O)/C=C\C(=O)O.[Mn].
What is the InChIKey of (Z)-but-2-enedioic acid;ethene;manganese?
The InChIKey is NAMTTZIYKDNVFJ-UAIGNFCESA-N. The full InChI is InChI=1S/C4H4O4.C2H4.Mn/c5-3(6)1-2-4(7)8;1-2;/h1-2H,(H,5,6)(H,7,8);1-2H2;/b2-1-;;.
What are the key properties of (Z)-but-2-enedioic acid;ethene;manganese?
(Z)-but-2-enedioic acid;ethene;manganese has a molecular weight of 199.06 g/mol, XLogP of 0.51, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;ethene;manganese is sourced from PubChem (CID 54606396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).