C52H36CuN4O8-4 — CID 54606562
copper;methyl 4-[(5Z,9Z,15Z,19Z)-10,15,20-tris(4-methoxycarbonylphenyl)porphyrin-21,22,23,24-tetraid-5-yl]benzoate (PubChem CID 54606562) has the molecular formula C52H36CuN4O8-4 and a molecular weight of 908.43 g/mol. Its IUPAC name is copper;methyl 4-[(5Z,9Z,15Z,19Z)-10,15,20-tris(4-methoxycarbonylphenyl)porphyrin-21,22,23,24-tetraid-5-yl]benzoate.
| Compound Name | copper;methyl 4-[(5Z,9Z,15Z,19Z)-10,15,20-tris(4-methoxycarbonylphenyl)porphyrin-21,22,23,24-tetraid-5-yl]benzoate |
|---|---|
| PubChem CID | 54606562 |
| Molecular Formula | C52H36CuN4O8-4 |
| Molecular Weight | 908.43 g/mol |
| Exact Mass | 907.19 |
| IUPAC Name | copper;methyl 4-[(5Z,9Z,15Z,19Z)-10,15,20-tris(4-methoxycarbonylphenyl)porphyrin-21,22,23,24-tetraid-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(/C2=c3\cc/c([n-]3)=C(\c3ccc(C(=O)OC)cc3)c3ccc([n-]3)/C(c3ccc(C(=O)OC)cc3)=c3/cc/c([n-]3)=C(\c3ccc(C(=O)OC)cc3)c3ccc2[n-]3)cc1.[Cu] |
| InChI | InChI=1S/C52H38N4O8.Cu/c1-61-49(57)33-13-5-29(6-14-33)45-37-21-23-39(53-37)46(30-7-15-34(16-8-30)50(58)62-2)41-25-27-43(55-41)48(32-11-19-36(20-12-32)52(60)64-4)44-28-26-42(56-44)47(40-24-22-38(45)54-40)31-9-17-35(18-10-31)51(59)63-3;/h5-28H,1-4H3,(H2-2,53,54,55,56,57,58,59,60);/q-2;/p-2/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44-; |
| InChIKey | LQAWMSBZDFPWDH-NHZJRHMYSA-L |
| XLogP | 3.96 |
| TPSA | 161.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|