About (+)-5-Epi-Aristolochene
(+)-5-Epi-Aristolochene (PubChem CID 5460659) has the molecular formula C15H24
and a molecular weight of 204.35 g/mol. Its IUPAC name is (4R,4aR,6R)-4,4a-dimethyl-6-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene.
Molecular Properties
| Compound Name | (+)-5-Epi-Aristolochene |
| PubChem CID | 5460659 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | (4R,4aR,6R)-4,4a-dimethyl-6-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene |
| SMILES | C[C@@H]1CCCC2=CC[C@H](C[C@]12C)C(=C)C |
| InChI | InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h9,12-13H,1,5-8,10H2,2-4H3/t12-,13-,15-/m1/s1 |
| InChIKey | YONHOSLUBQJXPR-UMVBOHGHSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | 297 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (+)-5-Epi-Aristolochene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (+)-5-Epi-Aristolochene?
The IUPAC name of (+)-5-Epi-Aristolochene (CID 5460659) is (4R,4aR,6R)-4,4a-dimethyl-6-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene.
What is the SMILES notation for (+)-5-Epi-Aristolochene?
The canonical SMILES for (+)-5-Epi-Aristolochene is C[C@@H]1CCCC2=CC[C@H](C[C@]12C)C(=C)C.
What is the InChIKey of (+)-5-Epi-Aristolochene?
The InChIKey is YONHOSLUBQJXPR-UMVBOHGHSA-N. The full InChI is InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h9,12-13H,1,5-8,10H2,2-4H3/t12-,13-,15-/m1/s1.
What are the key properties of (+)-5-Epi-Aristolochene?
(+)-5-Epi-Aristolochene has a molecular weight of 204.35 g/mol, XLogP of 5.20, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (+)-5-Epi-Aristolochene is sourced from PubChem (CID 5460659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).