About ethyl 3-methyl-4-oxooctanoate
ethyl 3-methyl-4-oxooctanoate (PubChem CID 546068) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is ethyl 3-methyl-4-oxooctanoate.
Molecular Properties
| Compound Name | ethyl 3-methyl-4-oxooctanoate |
| PubChem CID | 546068 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | ethyl 3-methyl-4-oxooctanoate |
| SMILES | CCCCC(=O)C(C)CC(=O)OCC |
| InChI | InChI=1S/C11H20O3/c1-4-6-7-10(12)9(3)8-11(13)14-5-2/h9H,4-8H2,1-3H3 |
| InChIKey | JKOKEWAMUXHEHR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-methyl-4-oxooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methyl-4-oxooctanoate?
The IUPAC name of ethyl 3-methyl-4-oxooctanoate (CID 546068) is ethyl 3-methyl-4-oxooctanoate.
What is the SMILES notation for ethyl 3-methyl-4-oxooctanoate?
The canonical SMILES for ethyl 3-methyl-4-oxooctanoate is CCCCC(=O)C(C)CC(=O)OCC.
What is the InChIKey of ethyl 3-methyl-4-oxooctanoate?
The InChIKey is JKOKEWAMUXHEHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-4-6-7-10(12)9(3)8-11(13)14-5-2/h9H,4-8H2,1-3H3.
What are the key properties of ethyl 3-methyl-4-oxooctanoate?
ethyl 3-methyl-4-oxooctanoate has a molecular weight of 200.28 g/mol, XLogP of 2.34, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methyl-4-oxooctanoate is sourced from PubChem (CID 546068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).