C22H36O2 — CID 54606868
(3Z,5E)-4-ethyl-3,5-dimethylhepta-3,5-dien-2-one;4-ethyl-2,3,5,6-tetramethyl-2H-pyran (PubChem CID 54606868) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (3Z,5E)-4-ethyl-3,5-dimethylhepta-3,5-dien-2-one;4-ethyl-2,3,5,6-tetramethyl-2H-pyran.
| Compound Name | (3Z,5E)-4-ethyl-3,5-dimethylhepta-3,5-dien-2-one;4-ethyl-2,3,5,6-tetramethyl-2H-pyran |
|---|---|
| PubChem CID | 54606868 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (3Z,5E)-4-ethyl-3,5-dimethylhepta-3,5-dien-2-one;4-ethyl-2,3,5,6-tetramethyl-2H-pyran |
| SMILES | C/C=C(C)/C(CC)=C(/C)C(C)=O.CCC1=C(C)C(C)OC(C)=C1C |
| InChI | InChI=1S/2C11H18O/c1-6-11-7(2)9(4)12-10(5)8(11)3;1-6-8(3)11(7-2)9(4)10(5)12/h9H,6H2,1-5H3;6H,7H2,1-5H3/b;8-6+,11-9- |
| InChIKey | BSIWIEFVJKHEFE-ZCAAJMDMSA-N |
| XLogP | 6.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|