About N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride
N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride (PubChem CID 54606871) has the molecular formula C17H22ClN3
and a molecular weight of 303.84 g/mol. Its IUPAC name is N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride |
| PubChem CID | 54606871 |
| Molecular Formula | C17H22ClN3 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride |
| SMILES | CCN(CC)CCn1c2ccccc2c2cnccc21.Cl |
| InChI | InChI=1S/C17H21N3.ClH/c1-3-19(4-2)11-12-20-16-8-6-5-7-14(16)15-13-18-10-9-17(15)20;/h5-10,13H,3-4,11-12H2,1-2H3;1H |
| InChIKey | VIQMMGYPAROFPH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride?
The IUPAC name of N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride (CID 54606871) is N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride.
What is the SMILES notation for N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride?
The canonical SMILES for N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride is CCN(CC)CCn1c2ccccc2c2cnccc21.Cl.
What is the InChIKey of N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride?
The InChIKey is VIQMMGYPAROFPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3.ClH/c1-3-19(4-2)11-12-20-16-8-6-5-7-14(16)15-13-18-10-9-17(15)20;/h5-10,13H,3-4,11-12H2,1-2H3;1H.
What are the key properties of N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride?
N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride has a molecular weight of 303.84 g/mol, XLogP of 3.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-pyrido[4,3-b]indol-5-ylethanamine;hydrochloride is sourced from PubChem (CID 54606871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).