C11H30N3O4P — CID 54606896
5-N-(3-aminopropyl)-2,5-dimethylhexane-2,5-diamine;phosphoric acid (PubChem CID 54606896) has the molecular formula C11H30N3O4P and a molecular weight of 299.35 g/mol. Its IUPAC name is 5-N-(3-aminopropyl)-2,5-dimethylhexane-2,5-diamine;phosphoric acid.
| Compound Name | 5-N-(3-aminopropyl)-2,5-dimethylhexane-2,5-diamine;phosphoric acid |
|---|---|
| PubChem CID | 54606896 |
| Molecular Formula | C11H30N3O4P |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 5-N-(3-aminopropyl)-2,5-dimethylhexane-2,5-diamine;phosphoric acid |
| SMILES | CC(C)(N)CCC(C)(C)NCCCN.O=P(O)(O)O |
| InChI | InChI=1S/C11H27N3.H3O4P/c1-10(2,13)6-7-11(3,4)14-9-5-8-12;1-5(2,3)4/h14H,5-9,12-13H2,1-4H3;(H3,1,2,3,4) |
| InChIKey | VTPSTVIXKXSJQT-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|