About zinc 1,2-dihydropyridazine-3,6-dione
zinc 1,2-dihydropyridazine-3,6-dione (PubChem CID 54607216) has the molecular formula C4H4N2O2Zn+2
and a molecular weight of 177.48 g/mol. Its IUPAC name is zinc 1,2-dihydropyridazine-3,6-dione.
Molecular Properties
| Compound Name | zinc 1,2-dihydropyridazine-3,6-dione |
| PubChem CID | 54607216 |
| Molecular Formula | C4H4N2O2Zn+2 |
| Molecular Weight | 177.48 g/mol |
| Exact Mass | 175.96 |
| IUPAC Name | zinc 1,2-dihydropyridazine-3,6-dione |
| SMILES | O=c1ccc(=O)[nH][nH]1.[Zn+2] |
| InChI | InChI=1S/C4H4N2O2.Zn/c7-3-1-2-4(8)6-5-3;/h1-2H,(H,5,7)(H,6,8);/q;+2 |
| InChIKey | KRDJDPNWMXXZOV-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.48 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc 1,2-dihydropyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc 1,2-dihydropyridazine-3,6-dione?
The IUPAC name of zinc 1,2-dihydropyridazine-3,6-dione (CID 54607216) is zinc 1,2-dihydropyridazine-3,6-dione.
What is the SMILES notation for zinc 1,2-dihydropyridazine-3,6-dione?
The canonical SMILES for zinc 1,2-dihydropyridazine-3,6-dione is O=c1ccc(=O)[nH][nH]1.[Zn+2].
What is the InChIKey of zinc 1,2-dihydropyridazine-3,6-dione?
The InChIKey is KRDJDPNWMXXZOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.Zn/c7-3-1-2-4(8)6-5-3;/h1-2H,(H,5,7)(H,6,8);/q;+2.
What are the key properties of zinc 1,2-dihydropyridazine-3,6-dione?
zinc 1,2-dihydropyridazine-3,6-dione has a molecular weight of 177.48 g/mol, XLogP of -0.94, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc 1,2-dihydropyridazine-3,6-dione is sourced from PubChem (CID 54607216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).