About heptalene
heptalene (PubChem CID 5460725) has the molecular formula C12H10
and a molecular weight of 154.21 g/mol. Its IUPAC name is heptalene.
Molecular Properties
| Compound Name | heptalene |
| PubChem CID | 5460725 |
| Molecular Formula | C12H10 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | heptalene |
| SMILES | C1=CC=C2C=CC=CC=C2C=C1 |
| InChI | InChI=1S/C12H10/c1-3-7-11-9-5-2-6-10-12(11)8-4-1/h1-10H |
| InChIKey | DDTGNKBZWQHIEH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze heptalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptalene?
The IUPAC name of heptalene (CID 5460725) is heptalene.
What is the SMILES notation for heptalene?
The canonical SMILES for heptalene is C1=CC=C2C=CC=CC=C2C=C1.
What is the InChIKey of heptalene?
The InChIKey is DDTGNKBZWQHIEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10/c1-3-7-11-9-5-2-6-10-12(11)8-4-1/h1-10H.
What are the key properties of heptalene?
heptalene has a molecular weight of 154.21 g/mol, XLogP of 3.09, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptalene is sourced from PubChem (CID 5460725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).