C14H21N3O2 — CID 54607276
1-[2-(4-ethenylpiperidin-1-yl)ethyl]-5-methylpyrimidine-2,4-dione (PubChem CID 54607276) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-[2-(4-ethenylpiperidin-1-yl)ethyl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[2-(4-ethenylpiperidin-1-yl)ethyl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54607276 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 1-[2-(4-ethenylpiperidin-1-yl)ethyl]-5-methylpyrimidine-2,4-dione |
| SMILES | C=CC1CCN(CCn2cc(C)c(=O)[nH]c2=O)CC1 |
| InChI | InChI=1S/C14H21N3O2/c1-3-12-4-6-16(7-5-12)8-9-17-10-11(2)13(18)15-14(17)19/h3,10,12H,1,4-9H2,2H3,(H,15,18,19) |
| InChIKey | MQPQAEHPHTWJCQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|