About s-indacene
s-indacene (PubChem CID 5460734) has the molecular formula C12H8
and a molecular weight of 152.20 g/mol. Its IUPAC name is s-indacene.
Molecular Properties
| Compound Name | s-indacene |
| PubChem CID | 5460734 |
| Molecular Formula | C12H8 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | s-indacene |
| SMILES | C1=Cc2cc3c(cc2=C1)C=CC=3 |
| InChI | InChI=1S/C12H8/c1-3-9-7-11-5-2-6-12(11)8-10(9)4-1/h1-8H |
| InChIKey | WEMQMWWWCBYPOV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze s-indacene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of s-indacene?
The IUPAC name of s-indacene (CID 5460734) is s-indacene.
What is the SMILES notation for s-indacene?
The canonical SMILES for s-indacene is C1=Cc2cc3c(cc2=C1)C=CC=3.
What is the InChIKey of s-indacene?
The InChIKey is WEMQMWWWCBYPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8/c1-3-9-7-11-5-2-6-12(11)8-10(9)4-1/h1-8H.
What are the key properties of s-indacene?
s-indacene has a molecular weight of 152.20 g/mol, XLogP of 1.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for s-indacene is sourced from PubChem (CID 5460734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).