About 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane
2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane (PubChem CID 54607558) has the molecular formula C17H22Cl2O2
and a molecular weight of 329.27 g/mol. Its IUPAC name is 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane |
| PubChem CID | 54607558 |
| Molecular Formula | C17H22Cl2O2 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane |
| SMILES | CCCCCCC1(/C=C\c2ccc(Cl)c(Cl)c2)OCCO1 |
| InChI | InChI=1S/C17H22Cl2O2/c1-2-3-4-5-9-17(20-11-12-21-17)10-8-14-6-7-15(18)16(19)13-14/h6-8,10,13H,2-5,9,11-12H2,1H3/b10-8- |
| InChIKey | FRZRNKRJFAQXCX-NTMALXAHSA-N |
| XLogP | 5.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane?
The IUPAC name of 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane (CID 54607558) is 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane.
What is the SMILES notation for 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane?
The canonical SMILES for 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane is CCCCCCC1(/C=C\c2ccc(Cl)c(Cl)c2)OCCO1.
What is the InChIKey of 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane?
The InChIKey is FRZRNKRJFAQXCX-NTMALXAHSA-N. The full InChI is InChI=1S/C17H22Cl2O2/c1-2-3-4-5-9-17(20-11-12-21-17)10-8-14-6-7-15(18)16(19)13-14/h6-8,10,13H,2-5,9,11-12H2,1H3/b10-8-.
What are the key properties of 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane?
2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane has a molecular weight of 329.27 g/mol, XLogP of 5.72, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-2-(3,4-dichlorophenyl)ethenyl]-2-hexyl-1,3-dioxolane is sourced from PubChem (CID 54607558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).