About (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile
(Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile (PubChem CID 54607727) has the molecular formula C14H8N4O4S2
and a molecular weight of 360.38 g/mol. Its IUPAC name is (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile |
| PubChem CID | 54607727 |
| Molecular Formula | C14H8N4O4S2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile |
| SMILES | N#C/C=C/c1ccc([N+](=O)[O-])s1.N#C/C=C\c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/2C7H4N2O2S/c2*8-5-1-2-6-3-4-7(12-6)9(10)11/h2*1-4H/b2-1+;2-1- |
| InChIKey | PNCUQIPWOQATJH-KDTZGSNLSA-N |
| XLogP | 4.39 |
| TPSA | 133.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile?
The IUPAC name of (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile (CID 54607727) is (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile.
What is the SMILES notation for (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile?
The canonical SMILES for (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile is N#C/C=C/c1ccc([N+](=O)[O-])s1.N#C/C=C\c1ccc([N+](=O)[O-])s1.
What is the InChIKey of (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile?
The InChIKey is PNCUQIPWOQATJH-KDTZGSNLSA-N. The full InChI is InChI=1S/2C7H4N2O2S/c2*8-5-1-2-6-3-4-7(12-6)9(10)11/h2*1-4H/b2-1+;2-1-.
What are the key properties of (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile?
(Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile has a molecular weight of 360.38 g/mol, XLogP of 4.39, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile;(E)-3-(5-nitrothiophen-2-yl)prop-2-enenitrile is sourced from PubChem (CID 54607727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).