About (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol
(1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol (PubChem CID 54608137) has the molecular formula C11H14N2O3
and a molecular weight of 222.24 g/mol. Its IUPAC name is (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol.
Molecular Properties
| Compound Name | (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol |
| PubChem CID | 54608137 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol |
| SMILES | C/C(CC(O)(/C=N/O)c1ccccc1)=N/O |
| InChI | InChI=1S/C11H14N2O3/c1-9(13-16)7-11(14,8-12-15)10-5-3-2-4-6-10/h2-6,8,14-16H,7H2,1H3/b12-8+,13-9- |
| InChIKey | YPDDLKPWPQSEFM-UQXQTEIVSA-N |
| XLogP | 1.57 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol?
The IUPAC name of (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol (CID 54608137) is (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol.
What is the SMILES notation for (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol?
The canonical SMILES for (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol is C/C(CC(O)(/C=N/O)c1ccccc1)=N/O.
What is the InChIKey of (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol?
The InChIKey is YPDDLKPWPQSEFM-UQXQTEIVSA-N. The full InChI is InChI=1S/C11H14N2O3/c1-9(13-16)7-11(14,8-12-15)10-5-3-2-4-6-10/h2-6,8,14-16H,7H2,1H3/b12-8+,13-9-.
What are the key properties of (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol?
(1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol has a molecular weight of 222.24 g/mol, XLogP of 1.57, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,4Z)-1,4-bis(hydroxyimino)-2-phenylpentan-2-ol is sourced from PubChem (CID 54608137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).