About 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide
1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide (PubChem CID 54608217) has the molecular formula C21H22IN
and a molecular weight of 415.32 g/mol. Its IUPAC name is 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide.
Molecular Properties
| Compound Name | 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide |
| PubChem CID | 54608217 |
| Molecular Formula | C21H22IN |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide |
| SMILES | Cc1cc(C)c(/C=C\c2cc[n+](C)c3ccccc23)c(C)c1.[I-] |
| InChI | InChI=1S/C21H22N.HI/c1-15-13-16(2)19(17(3)14-15)10-9-18-11-12-22(4)21-8-6-5-7-20(18)21;/h5-14H,1-4H3;1H/q+1;/p-1/b10-9-; |
| InChIKey | FSAIBCHGEVKKGZ-KVVVOXFISA-M |
| XLogP | 1.76 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide?
The IUPAC name of 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide (CID 54608217) is 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide.
What is the SMILES notation for 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide?
The canonical SMILES for 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide is Cc1cc(C)c(/C=C\c2cc[n+](C)c3ccccc23)c(C)c1.[I-].
What is the InChIKey of 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide?
The InChIKey is FSAIBCHGEVKKGZ-KVVVOXFISA-M. The full InChI is InChI=1S/C21H22N.HI/c1-15-13-16(2)19(17(3)14-15)10-9-18-11-12-22(4)21-8-6-5-7-20(18)21;/h5-14H,1-4H3;1H/q+1;/p-1/b10-9-;.
What are the key properties of 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide?
1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide has a molecular weight of 415.32 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(Z)-2-(2,4,6-trimethylphenyl)ethenyl]quinolin-1-ium iodide is sourced from PubChem (CID 54608217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).