C11H16N2NaO2S+ — CID 54608287
sodium 5,5-diethyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 54608287) has the molecular formula C11H16N2NaO2S+ and a molecular weight of 263.32 g/mol. Its IUPAC name is sodium 5,5-diethyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | sodium 5,5-diethyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 54608287 |
| Molecular Formula | C11H16N2NaO2S+ |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | sodium 5,5-diethyl-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCN1C(=O)C(CC)(CC)C(=O)NC1=S.[Na+] |
| InChI | InChI=1S/C11H16N2O2S.Na/c1-4-7-13-9(15)11(5-2,6-3)8(14)12-10(13)16;/h4H,1,5-7H2,2-3H3,(H,12,14,16);/q;+1 |
| InChIKey | DSPCHRXQBWIGSG-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|