C24H36Cl2N2O6 — CID 54608539
(4R,6R)-6-(chloromethyl)-4-[[(6S)-6-[[(4R,6R)-6-(chloromethyl)-4-cyano-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane-4-carbonitrile (PubChem CID 54608539) has the molecular formula C24H36Cl2N2O6 and a molecular weight of 519.47 g/mol. Its IUPAC name is (4R,6R)-6-(chloromethyl)-4-[[(6S)-6-[[(4R,6R)-6-(chloromethyl)-4-cyano-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane-4-carbonitrile.
| Compound Name | (4R,6R)-6-(chloromethyl)-4-[[(6S)-6-[[(4R,6R)-6-(chloromethyl)-4-cyano-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane-4-carbonitrile |
|---|---|
| PubChem CID | 54608539 |
| Molecular Formula | C24H36Cl2N2O6 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | (4R,6R)-6-(chloromethyl)-4-[[(6S)-6-[[(4R,6R)-6-(chloromethyl)-4-cyano-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxane-4-carbonitrile |
| SMILES | CC1(C)OC(C[C@]2(C#N)C[C@H](CCl)OC(C)(C)O2)C[C@@H](C[C@]2(C#N)C[C@H](CCl)OC(C)(C)O2)O1 |
| InChI | InChI=1S/C24H36Cl2N2O6/c1-20(2)29-16(8-23(14-27)10-18(12-25)31-21(3,4)33-23)7-17(30-20)9-24(15-28)11-19(13-26)32-22(5,6)34-24/h16-19H,7-13H2,1-6H3/t16-,17?,18+,19+,23+,24+/m0/s1 |
| InChIKey | QRQJMYPKSQCRNW-OKJKAMIVSA-N |
| XLogP | 4.76 |
| TPSA | 102.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|