About butyl 4,4-dibutoxybutanoate
butyl 4,4-dibutoxybutanoate (PubChem CID 546087) has the molecular formula C16H32O4
and a molecular weight of 288.43 g/mol. Its IUPAC name is butyl 4,4-dibutoxybutanoate.
Molecular Properties
| Compound Name | butyl 4,4-dibutoxybutanoate |
| PubChem CID | 546087 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | butyl 4,4-dibutoxybutanoate |
| SMILES | CCCCOC(=O)CCC(OCCCC)OCCCC |
| InChI | InChI=1S/C16H32O4/c1-4-7-12-18-15(17)10-11-16(19-13-8-5-2)20-14-9-6-3/h16H,4-14H2,1-3H3 |
| InChIKey | BFRUFTRQPXERPA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze butyl 4,4-dibutoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4,4-dibutoxybutanoate?
The IUPAC name of butyl 4,4-dibutoxybutanoate (CID 546087) is butyl 4,4-dibutoxybutanoate.
What is the SMILES notation for butyl 4,4-dibutoxybutanoate?
The canonical SMILES for butyl 4,4-dibutoxybutanoate is CCCCOC(=O)CCC(OCCCC)OCCCC.
What is the InChIKey of butyl 4,4-dibutoxybutanoate?
The InChIKey is BFRUFTRQPXERPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O4/c1-4-7-12-18-15(17)10-11-16(19-13-8-5-2)20-14-9-6-3/h16H,4-14H2,1-3H3.
What are the key properties of butyl 4,4-dibutoxybutanoate?
butyl 4,4-dibutoxybutanoate has a molecular weight of 288.43 g/mol, XLogP of 4.07, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4,4-dibutoxybutanoate is sourced from PubChem (CID 546087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).