About 3,18-Dolabelladiene
3,18-Dolabelladiene (PubChem CID 54608901) has the molecular formula C20H30O2
and a molecular weight of 302.50 g/mol. Its IUPAC name is (1S,3R,5R,8E,12R,13S)-1,5,9-trimethyl-13-prop-1-en-2-yl-4-oxatricyclo[10.3.0.03,5]pentadec-8-en-15-one.
Molecular Properties
| Compound Name | 3,18-Dolabelladiene |
| PubChem CID | 54608901 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,3R,5R,8E,12R,13S)-1,5,9-trimethyl-13-prop-1-en-2-yl-4-oxatricyclo[10.3.0.03,5]pentadec-8-en-15-one |
| SMILES | C/C/1=C\CC[C@@]2([C@H](O2)C[C@]3([C@H](CC1)[C@H](CC3=O)C(=C)C)C)C |
| InChI | InChI=1S/C20H30O2/c1-13(2)15-11-17(21)19(4)12-18-20(5,22-18)10-6-7-14(3)8-9-16(15)19/h7,15-16,18H,1,6,8-12H2,2-5H3/b14-7+/t15-,16-,18-,19+,20-/m1/s1 |
| InChIKey | GUSAEAVUMKCIQK-LQRBVDFWSA-N |
| XLogP | 4.10 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | 532 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,18-Dolabelladiene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,18-Dolabelladiene?
The IUPAC name of 3,18-Dolabelladiene (CID 54608901) is (1S,3R,5R,8E,12R,13S)-1,5,9-trimethyl-13-prop-1-en-2-yl-4-oxatricyclo[10.3.0.03,5]pentadec-8-en-15-one.
What is the SMILES notation for 3,18-Dolabelladiene?
The canonical SMILES for 3,18-Dolabelladiene is C/C/1=C\CC[C@@]2([C@H](O2)C[C@]3([C@H](CC1)[C@H](CC3=O)C(=C)C)C)C.
What is the InChIKey of 3,18-Dolabelladiene?
The InChIKey is GUSAEAVUMKCIQK-LQRBVDFWSA-N. The full InChI is InChI=1S/C20H30O2/c1-13(2)15-11-17(21)19(4)12-18-20(5,22-18)10-6-7-14(3)8-9-16(15)19/h7,15-16,18H,1,6,8-12H2,2-5H3/b14-7+/t15-,16-,18-,19+,20-/m1/s1.
What are the key properties of 3,18-Dolabelladiene?
3,18-Dolabelladiene has a molecular weight of 302.50 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,18-Dolabelladiene is sourced from PubChem (CID 54608901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).