C16H21BrClNO4 — CID 54608918
(3S)-1-[(4-bromophenyl)methyl]-3-[(1R)-1-chloroethyl]piperidine;oxalic acid (PubChem CID 54608918) has the molecular formula C16H21BrClNO4 and a molecular weight of 406.70 g/mol. Its IUPAC name is (3S)-1-[(4-bromophenyl)methyl]-3-[(1R)-1-chloroethyl]piperidine;oxalic acid.
| Compound Name | (3S)-1-[(4-bromophenyl)methyl]-3-[(1R)-1-chloroethyl]piperidine;oxalic acid |
|---|---|
| PubChem CID | 54608918 |
| Molecular Formula | C16H21BrClNO4 |
| Molecular Weight | 406.70 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | (3S)-1-[(4-bromophenyl)methyl]-3-[(1R)-1-chloroethyl]piperidine;oxalic acid |
| SMILES | C[C@@H](Cl)[C@H]1CCCN(Cc2ccc(Br)cc2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H19BrClN.C2H2O4/c1-11(16)13-3-2-8-17(10-13)9-12-4-6-14(15)7-5-12;3-1(4)2(5)6/h4-7,11,13H,2-3,8-10H2,1H3;(H,3,4)(H,5,6)/t11-,13+;/m1./s1 |
| InChIKey | YRKCBEFGIFMLRY-YLAFAASESA-N |
| XLogP | 3.44 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.70 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|