C6H6F8NaO8S2+ — CID 54608922
sodium 2,2,3,3,4,4,5,5-octafluoro-1,6-dihydroxyhexane-1,6-disulfonic acid (PubChem CID 54608922) has the molecular formula C6H6F8NaO8S2+ and a molecular weight of 445.21 g/mol. Its IUPAC name is sodium 2,2,3,3,4,4,5,5-octafluoro-1,6-dihydroxyhexane-1,6-disulfonic acid.
| Compound Name | sodium 2,2,3,3,4,4,5,5-octafluoro-1,6-dihydroxyhexane-1,6-disulfonic acid |
|---|---|
| PubChem CID | 54608922 |
| Molecular Formula | C6H6F8NaO8S2+ |
| Molecular Weight | 445.21 g/mol |
| Exact Mass | 444.93 |
| IUPAC Name | sodium 2,2,3,3,4,4,5,5-octafluoro-1,6-dihydroxyhexane-1,6-disulfonic acid |
| SMILES | O=S(=O)(O)C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C6H6F8O8S2.Na/c7-3(8,1(15)23(17,18)19)5(11,12)6(13,14)4(9,10)2(16)24(20,21)22;/h1-2,15-16H,(H,17,18,19)(H,20,21,22);/q;+1 |
| InChIKey | UQVQVUGRPSCVKT-UHFFFAOYSA-N |
| XLogP | -3.06 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.21 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|