C25H15N3O — CID 54608995
11-(4-methylphenyl)-2,12,15-triazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1,3,5,7,9,11,13(21),14(19),15,17-decaen-20-one (PubChem CID 54608995) has the molecular formula C25H15N3O and a molecular weight of 373.42 g/mol. Its IUPAC name is 11-(4-methylphenyl)-2,12,15-triazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1,3,5,7,9,11,13(21),14(19),15,17-decaen-20-one.
| Compound Name | 11-(4-methylphenyl)-2,12,15-triazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1,3,5,7,9,11,13(21),14(19),15,17-decaen-20-one |
|---|---|
| PubChem CID | 54608995 |
| Molecular Formula | C25H15N3O |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 11-(4-methylphenyl)-2,12,15-triazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-1,3,5,7,9,11,13(21),14(19),15,17-decaen-20-one |
| SMILES | Cc1ccc(-c2cc3c4c(nc5ccccc53)C(=O)c3cccnc3-c4n2)cc1 |
| InChI | InChI=1S/C25H15N3O/c1-14-8-10-15(11-9-14)20-13-18-16-5-2-3-7-19(16)27-24-21(18)23(28-20)22-17(25(24)29)6-4-12-26-22/h2-13H,1H3 |
| InChIKey | LVQTTZXQIGFSMZ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|