About 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride
2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride (PubChem CID 54609205) has the molecular formula C20H26ClNO
and a molecular weight of 331.89 g/mol. Its IUPAC name is 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride.
Molecular Properties
| Compound Name | 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride |
| PubChem CID | 54609205 |
| Molecular Formula | C20H26ClNO |
| Molecular Weight | 331.89 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride |
| SMILES | CN1CCC(CC(O)(c2ccccc2)c2ccccc2)CC1.Cl |
| InChI | InChI=1S/C20H25NO.ClH/c1-21-14-12-17(13-15-21)16-20(22,18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,17,22H,12-16H2,1H3;1H |
| InChIKey | VWQRVXWCELRRMF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.89 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride?
The IUPAC name of 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride (CID 54609205) is 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride.
What is the SMILES notation for 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride?
The canonical SMILES for 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride is CN1CCC(CC(O)(c2ccccc2)c2ccccc2)CC1.Cl.
What is the InChIKey of 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride?
The InChIKey is VWQRVXWCELRRMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NO.ClH/c1-21-14-12-17(13-15-21)16-20(22,18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,17,22H,12-16H2,1H3;1H.
What are the key properties of 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride?
2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride has a molecular weight of 331.89 g/mol, XLogP of 4.08, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methylpiperidin-4-yl)-1,1-diphenylethanol;hydrochloride is sourced from PubChem (CID 54609205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).