About 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride
1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride (PubChem CID 54609270) has the molecular formula C18H20ClN
and a molecular weight of 285.82 g/mol. Its IUPAC name is 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride.
Molecular Properties
| Compound Name | 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride |
| PubChem CID | 54609270 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride |
| SMILES | CN1CCCC(c2ccccc2)=C1c1ccccc1.Cl |
| InChI | InChI=1S/C18H19N.ClH/c1-19-14-8-13-17(15-9-4-2-5-10-15)18(19)16-11-6-3-7-12-16;/h2-7,9-12H,8,13-14H2,1H3;1H |
| InChIKey | HJKRWUFXDHAFGB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride?
The IUPAC name of 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride (CID 54609270) is 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride.
What is the SMILES notation for 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride?
The canonical SMILES for 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride is CN1CCCC(c2ccccc2)=C1c1ccccc1.Cl.
What is the InChIKey of 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride?
The InChIKey is HJKRWUFXDHAFGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N.ClH/c1-19-14-8-13-17(15-9-4-2-5-10-15)18(19)16-11-6-3-7-12-16;/h2-7,9-12H,8,13-14H2,1H3;1H.
What are the key properties of 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride?
1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride has a molecular weight of 285.82 g/mol, XLogP of 4.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5,6-diphenyl-3,4-dihydro-2H-pyridine;hydrochloride is sourced from PubChem (CID 54609270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).