About (4S,5S)-4,5-dihydroxyhexanal
(4S,5S)-4,5-dihydroxyhexanal (PubChem CID 5460960) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is (4S,5S)-4,5-dihydroxyhexanal.
Molecular Properties
| Compound Name | (4S,5S)-4,5-dihydroxyhexanal |
| PubChem CID | 5460960 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (4S,5S)-4,5-dihydroxyhexanal |
| SMILES | C[C@H](O)[C@@H](O)CCC=O |
| InChI | InChI=1S/C6H12O3/c1-5(8)6(9)3-2-4-7/h4-6,8-9H,2-3H2,1H3/t5-,6-/m0/s1 |
| InChIKey | XXIHHRIZGBRENI-WDSKDSINSA-N |
| XLogP | -0.29 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4S,5S)-4,5-dihydroxyhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4,5-dihydroxyhexanal?
The IUPAC name of (4S,5S)-4,5-dihydroxyhexanal (CID 5460960) is (4S,5S)-4,5-dihydroxyhexanal.
What is the SMILES notation for (4S,5S)-4,5-dihydroxyhexanal?
The canonical SMILES for (4S,5S)-4,5-dihydroxyhexanal is C[C@H](O)[C@@H](O)CCC=O.
What is the InChIKey of (4S,5S)-4,5-dihydroxyhexanal?
The InChIKey is XXIHHRIZGBRENI-WDSKDSINSA-N. The full InChI is InChI=1S/C6H12O3/c1-5(8)6(9)3-2-4-7/h4-6,8-9H,2-3H2,1H3/t5-,6-/m0/s1.
What are the key properties of (4S,5S)-4,5-dihydroxyhexanal?
(4S,5S)-4,5-dihydroxyhexanal has a molecular weight of 132.16 g/mol, XLogP of -0.29, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4,5-dihydroxyhexanal is sourced from PubChem (CID 5460960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).