About 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride
4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride (PubChem CID 54609696) has the molecular formula C5H10ClN3S
and a molecular weight of 179.68 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride |
| PubChem CID | 54609696 |
| Molecular Formula | C5H10ClN3S |
| Molecular Weight | 179.68 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride |
| SMILES | Cl.NCCc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C5H9N3S.ClH/c6-2-1-4-3-7-5(9)8-4;/h3H,1-2,6H2,(H2,7,8,9);1H |
| InChIKey | JCSUXICYONJMEA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 57.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.68 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride?
The IUPAC name of 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride (CID 54609696) is 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride.
What is the SMILES notation for 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride?
The canonical SMILES for 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride is Cl.NCCc1c[nH]c(=S)[nH]1.
What is the InChIKey of 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride?
The InChIKey is JCSUXICYONJMEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S.ClH/c6-2-1-4-3-7-5(9)8-4;/h3H,1-2,6H2,(H2,7,8,9);1H.
What are the key properties of 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride?
4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride has a molecular weight of 179.68 g/mol, XLogP of 1.00, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-1,3-dihydroimidazole-2-thione;hydrochloride is sourced from PubChem (CID 54609696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).