About 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride
1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride (PubChem CID 54609805) has the molecular formula C19H21ClN2O3
and a molecular weight of 360.84 g/mol. Its IUPAC name is 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride.
Molecular Properties
| Compound Name | 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride |
| PubChem CID | 54609805 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride |
| SMILES | Cc1ccc(NCCNCCO)c2c1C(=O)c1ccccc1C2=O.Cl |
| InChI | InChI=1S/C19H20N2O3.ClH/c1-12-6-7-15(21-9-8-20-10-11-22)17-16(12)18(23)13-4-2-3-5-14(13)19(17)24;/h2-7,20-22H,8-11H2,1H3;1H |
| InChIKey | ZNPJJQOPFJAQCU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride?
The IUPAC name of 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride (CID 54609805) is 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride.
What is the SMILES notation for 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride?
The canonical SMILES for 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride is Cc1ccc(NCCNCCO)c2c1C(=O)c1ccccc1C2=O.Cl.
What is the InChIKey of 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride?
The InChIKey is ZNPJJQOPFJAQCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3.ClH/c1-12-6-7-15(21-9-8-20-10-11-22)17-16(12)18(23)13-4-2-3-5-14(13)19(17)24;/h2-7,20-22H,8-11H2,1H3;1H.
What are the key properties of 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride?
1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride has a molecular weight of 360.84 g/mol, XLogP of 2.19, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2-hydroxyethylamino)ethylamino]-4-methylanthracene-9,10-dione;hydrochloride is sourced from PubChem (CID 54609805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).