C42H48N2 — CID 54609936
(Z)-4-(3,4-dimethylphenyl)-N-[(Z)-[4-(3,4-dimethylphenyl)-4,6,7-trimethyl-2,3-dihydronaphthalen-1-ylidene]amino]-4,6,7-trimethyl-2,3-dihydronaphthalen-1-imine (PubChem CID 54609936) has the molecular formula C42H48N2 and a molecular weight of 580.86 g/mol. Its IUPAC name is (Z)-4-(3,4-dimethylphenyl)-N-[(Z)-[4-(3,4-dimethylphenyl)-4,6,7-trimethyl-2,3-dihydronaphthalen-1-ylidene]amino]-4,6,7-trimethyl-2,3-dihydronaphthalen-1-imine.
| Compound Name | (Z)-4-(3,4-dimethylphenyl)-N-[(Z)-[4-(3,4-dimethylphenyl)-4,6,7-trimethyl-2,3-dihydronaphthalen-1-ylidene]amino]-4,6,7-trimethyl-2,3-dihydronaphthalen-1-imine |
|---|---|
| PubChem CID | 54609936 |
| Molecular Formula | C42H48N2 |
| Molecular Weight | 580.86 g/mol |
| Exact Mass | 580.38 |
| IUPAC Name | (Z)-4-(3,4-dimethylphenyl)-N-[(Z)-[4-(3,4-dimethylphenyl)-4,6,7-trimethyl-2,3-dihydronaphthalen-1-ylidene]amino]-4,6,7-trimethyl-2,3-dihydronaphthalen-1-imine |
| SMILES | Cc1ccc(C2(C)CC/C(=N/N=C3/CCC(C)(c4ccc(C)c(C)c4)c4cc(C)c(C)cc43)c3cc(C)c(C)cc32)cc1C |
| InChI | InChI=1S/C42H48N2/c1-25-11-13-33(19-27(25)3)41(9)17-15-39(35-21-29(5)31(7)23-37(35)41)43-44-40-16-18-42(10,34-14-12-26(2)28(4)20-34)38-24-32(8)30(6)22-36(38)40/h11-14,19-24H,15-18H2,1-10H3/b43-39-,44-40- |
| InChIKey | MBXNBYCQXFRCLX-XRXZHQAKSA-N |
| XLogP | 10.55 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.86 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|