C18H29O2- — CID 5461005
(9Z,12Z,15Z)-octadeca-9,12,15-trienoate (PubChem CID 5461005) has the molecular formula C18H29O2- and a molecular weight of 277.43 g/mol. Its IUPAC name is (9Z,12Z,15Z)-octadeca-9,12,15-trienoate.
| Compound Name | (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
|---|---|
| PubChem CID | 5461005 |
| Molecular Formula | C18H29O2- |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/p-1/b4-3-,7-6-,10-9- |
| InChIKey | DTOSIQBPPRVQHS-PDBXOOCHSA-M |
| XLogP | 4.33 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|