About (Z)-hexadec-9-enoate
(Z)-hexadec-9-enoate (PubChem CID 5461012) has the molecular formula C16H29O2-
and a molecular weight of 253.41 g/mol. Its IUPAC name is (Z)-hexadec-9-enoate.
Molecular Properties
| Compound Name | (Z)-hexadec-9-enoate |
| PubChem CID | 5461012 |
| Molecular Formula | C16H29O2- |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | (Z)-hexadec-9-enoate |
| SMILES | CCCCCC/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/p-1/b8-7- |
| InChIKey | SECPZKHBENQXJG-FPLPWBNLSA-M |
| XLogP | 3.99 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-hexadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-hexadec-9-enoate?
The IUPAC name of (Z)-hexadec-9-enoate (CID 5461012) is (Z)-hexadec-9-enoate.
What is the SMILES notation for (Z)-hexadec-9-enoate?
The canonical SMILES for (Z)-hexadec-9-enoate is CCCCCC/C=C\CCCCCCCC(=O)[O-].
What is the InChIKey of (Z)-hexadec-9-enoate?
The InChIKey is SECPZKHBENQXJG-FPLPWBNLSA-M. The full InChI is InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h7-8H,2-6,9-15H2,1H3,(H,17,18)/p-1/b8-7-.
What are the key properties of (Z)-hexadec-9-enoate?
(Z)-hexadec-9-enoate has a molecular weight of 253.41 g/mol, XLogP of 3.99, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-hexadec-9-enoate is sourced from PubChem (CID 5461012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).