About icosanoate
icosanoate (PubChem CID 5461017) has the molecular formula C20H39O2-
and a molecular weight of 311.53 g/mol. Its IUPAC name is icosanoate.
Molecular Properties
| Compound Name | icosanoate |
| PubChem CID | 5461017 |
| Molecular Formula | C20H39O2- |
| Molecular Weight | 311.53 g/mol |
| Exact Mass | 311.30 |
| IUPAC Name | icosanoate |
| SMILES | CCCCCCCCCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22)/p-1 |
| InChIKey | VKOBVWXKNCXXDE-UHFFFAOYSA-M |
| XLogP | 5.78 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze icosanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of icosanoate?
The IUPAC name of icosanoate (CID 5461017) is icosanoate.
What is the SMILES notation for icosanoate?
The canonical SMILES for icosanoate is CCCCCCCCCCCCCCCCCCCC(=O)[O-].
What is the InChIKey of icosanoate?
The InChIKey is VKOBVWXKNCXXDE-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h2-19H2,1H3,(H,21,22)/p-1.
What are the key properties of icosanoate?
icosanoate has a molecular weight of 311.53 g/mol, XLogP of 5.78, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for icosanoate is sourced from PubChem (CID 5461017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).