About 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide
4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide (PubChem CID 54610208) has the molecular formula C18H16INO2
and a molecular weight of 405.24 g/mol. Its IUPAC name is 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide.
Molecular Properties
| Compound Name | 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide |
| PubChem CID | 54610208 |
| Molecular Formula | C18H16INO2 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide |
| SMILES | C[n+]1ccc(/C=C/c2ccc(O)c(O)c2)c2ccccc21.[I-] |
| InChI | InChI=1S/C18H15NO2.HI/c1-19-11-10-14(15-4-2-3-5-16(15)19)8-6-13-7-9-17(20)18(21)12-13;/h2-12,21H,1H3;1H |
| InChIKey | TWDWXXDVHFQLPG-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide?
The IUPAC name of 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide (CID 54610208) is 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide.
What is the SMILES notation for 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide?
The canonical SMILES for 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide is C[n+]1ccc(/C=C/c2ccc(O)c(O)c2)c2ccccc21.[I-].
What is the InChIKey of 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide?
The InChIKey is TWDWXXDVHFQLPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO2.HI/c1-19-11-10-14(15-4-2-3-5-16(15)19)8-6-13-7-9-17(20)18(21)12-13;/h2-12,21H,1H3;1H.
What are the key properties of 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide?
4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide has a molecular weight of 405.24 g/mol, XLogP of 0.25, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(1-methylquinolin-1-ium-4-yl)ethenyl]benzene-1,2-diol iodide is sourced from PubChem (CID 54610208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).