C8H16O5 — CID 5461025
(2R,3S,4R)-2,3,5-trihydroxy-4-methoxy-5-methylhexanal (PubChem CID 5461025) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is (2R,3S,4R)-2,3,5-trihydroxy-4-methoxy-5-methylhexanal.
| Compound Name | (2R,3S,4R)-2,3,5-trihydroxy-4-methoxy-5-methylhexanal |
|---|---|
| PubChem CID | 5461025 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (2R,3S,4R)-2,3,5-trihydroxy-4-methoxy-5-methylhexanal |
| SMILES | CO[C@H]([C@@H](O)[C@@H](O)C=O)C(C)(C)O |
| InChI | InChI=1S/C8H16O5/c1-8(2,12)7(13-3)6(11)5(10)4-9/h4-7,10-12H,1-3H3/t5-,6-,7+/m0/s1 |
| InChIKey | VXFVJCLMUVIKKX-LYFYHCNISA-N |
| XLogP | -1.31 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|