C22H30ClN7O2 — CID 54610259
8-N-[5-(diethylamino)pentan-2-yl]-3-(4-nitrophenyl)pyrido[2,3-b]pyrazine-6,8-diamine;hydrochloride (PubChem CID 54610259) has the molecular formula C22H30ClN7O2 and a molecular weight of 459.98 g/mol. Its IUPAC name is 8-N-[5-(diethylamino)pentan-2-yl]-3-(4-nitrophenyl)pyrido[2,3-b]pyrazine-6,8-diamine;hydrochloride.
| Compound Name | 8-N-[5-(diethylamino)pentan-2-yl]-3-(4-nitrophenyl)pyrido[2,3-b]pyrazine-6,8-diamine;hydrochloride |
|---|---|
| PubChem CID | 54610259 |
| Molecular Formula | C22H30ClN7O2 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 8-N-[5-(diethylamino)pentan-2-yl]-3-(4-nitrophenyl)pyrido[2,3-b]pyrazine-6,8-diamine;hydrochloride |
| SMILES | CCN(CC)CCCC(C)Nc1cc(N)nc2nc(-c3ccc([N+](=O)[O-])cc3)cnc12.Cl |
| InChI | InChI=1S/C22H29N7O2.ClH/c1-4-28(5-2)12-6-7-15(3)25-18-13-20(23)27-22-21(18)24-14-19(26-22)16-8-10-17(11-9-16)29(30)31;/h8-11,13-15H,4-7,12H2,1-3H3,(H3,23,25,26,27);1H |
| InChIKey | NUTUNUKSJDKQDL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|