C7H14O5 — CID 5461037
(2S,3S,4R,5R)-2,3,4,5-tetrahydroxy-3-methylhexanal (PubChem CID 5461037) has the molecular formula C7H14O5 and a molecular weight of 178.18 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2,3,4,5-tetrahydroxy-3-methylhexanal.
| Compound Name | (2S,3S,4R,5R)-2,3,4,5-tetrahydroxy-3-methylhexanal |
|---|---|
| PubChem CID | 5461037 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (2S,3S,4R,5R)-2,3,4,5-tetrahydroxy-3-methylhexanal |
| SMILES | C[C@@H](O)[C@@H](O)[C@](C)(O)[C@H](O)C=O |
| InChI | InChI=1S/C7H14O5/c1-4(9)6(11)7(2,12)5(10)3-8/h3-6,9-12H,1-2H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | AWWDAEYRNORHRF-DBRKOABJSA-N |
| XLogP | -1.96 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|